CAS 560082-52-2 is the registry number for 7,8-Difluoro-3,4-dihydro-2H-1,4-benzoxazin-3-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
7,8-difluoro-4H-1,4-benzoxazin-3-one (CAS 560082-52-2) is a chemical compound with the molecular formula C8H5F2NO2 and a molecular weight of 185.13 g/mol. IUPAC name: 7,8-difluoro-4H-1,4-benzoxazin-3-one. InChIKey: JCNKLQRINZTFII-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO2 |
|---|---|
| Molecular weight | 185.13 g/mol |
| IUPAC name | 7,8-difluoro-4H-1,4-benzoxazin-3-one |
| InChIKey | JCNKLQRINZTFII-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C(=C(C=C2)F)F |
Computed by PubChem (NCBI)