CAS 2137795-69-6 is the registry number for 6,7-Difluoro-1,4-dihydro-2H-benzo[d][1,3]oxazin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,7-difluoro-1,4-dihydro-3,1-benzoxazin-2-one (CAS 2137795-69-6) is a chemical compound with the molecular formula C8H5F2NO2 and a molecular weight of 185.13 g/mol. IUPAC name: 6,7-difluoro-1,4-dihydro-3,1-benzoxazin-2-one. InChIKey: OUQHYBKOARTAHN-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO2 |
|---|---|
| Molecular weight | 185.13 g/mol |
| IUPAC name | 6,7-difluoro-1,4-dihydro-3,1-benzoxazin-2-one |
| InChIKey | OUQHYBKOARTAHN-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=C(C=C2NC(=O)O1)F)F |
Computed by PubChem (NCBI)