CAS 102587-39-3 is the registry number for 3',4'–DICHLORO–3–METHYLBENZANILIDE. Offered by: GLPBio. Available pack sizes: 250mg.
N-(3,4-dichlorophenyl)-3-methylbenzamide (CAS 102587-39-3) is a chemical compound with the molecular formula C14H11Cl2NO and a molecular weight of 280.1 g/mol. IUPAC name: N-(3,4-dichlorophenyl)-3-methylbenzamide. InChIKey: UTSFDDXXONJZBV-UHFFFAOYSA-N.
| Molecular formula | C14H11Cl2NO |
|---|---|
| Molecular weight | 280.1 g/mol |
| IUPAC name | N-(3,4-dichlorophenyl)-3-methylbenzamide |
| InChIKey | UTSFDDXXONJZBV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)NC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)