CAS 84803-53-2 appears in our catalog under these names: Diclofenac Impurity 49, Diclofenac sodium Impurity 52, N-Acetyl-2,6-dichlorodiphenylamine, N-Acetyl-N-phenyl-2,6-dichloroaniline. Offered by: Chemat Brand, TRC, Mikromol. Available pack sizes: on request, 750mg, 4x25mg, 25mg, 100mg.
N-(2,6-dichlorophenyl)-N-phenylacetamide (CAS 84803-53-2) is a chemical compound with the molecular formula C14H11Cl2NO and a molecular weight of 280.1 g/mol. IUPAC name: N-(2,6-dichlorophenyl)-N-phenylacetamide. InChIKey: WKSKHBFEWVRZEZ-UHFFFAOYSA-N.
| Molecular formula | C14H11Cl2NO |
|---|---|
| Molecular weight | 280.1 g/mol |
| IUPAC name | N-(2,6-dichlorophenyl)-N-phenylacetamide |
| InChIKey | WKSKHBFEWVRZEZ-UHFFFAOYSA-N |
| SMILES | CC(=O)N(C1=CC=CC=C1)C2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)