CAS 157491-15-1 is the registry number for N-(2,6-Dichlorophenyl)-3-methylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-(2,6-dichlorophenyl)-3-methylbenzamide (CAS 157491-15-1) is a chemical compound with the molecular formula C14H11Cl2NO and a molecular weight of 280.1 g/mol. IUPAC name: N-(2,6-dichlorophenyl)-3-methylbenzamide. InChIKey: PISANCSDQOSBCO-UHFFFAOYSA-N.
| Molecular formula | C14H11Cl2NO |
|---|---|
| Molecular weight | 280.1 g/mol |
| IUPAC name | N-(2,6-dichlorophenyl)-3-methylbenzamide |
| InChIKey | PISANCSDQOSBCO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)NC2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)