Products 848060-64-0

CAS 848060-64-0 is the registry number for Diclofenac sodium Impurity 58. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(2,6-dichlorophenyl)-N-phenylacetamide (CAS 848060-64-0) is a chemical compound with the molecular formula C14H11Cl2NO and a molecular weight of 280.1 g/mol. IUPAC name: 2-(2,6-dichlorophenyl)-N-phenylacetamide. InChIKey: QCXDNBPNFDEUJZ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11Cl2NO
Molecular weight280.1 g/mol
IUPAC name2-(2,6-dichlorophenyl)-N-phenylacetamide
InChIKeyQCXDNBPNFDEUJZ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)NC(=O)CC2=C(C=CC=C2Cl)Cl

Computed by PubChem (NCBI)