CAS 848060-64-0 is the registry number for Diclofenac sodium Impurity 58. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,6-dichlorophenyl)-N-phenylacetamide (CAS 848060-64-0) is a chemical compound with the molecular formula C14H11Cl2NO and a molecular weight of 280.1 g/mol. IUPAC name: 2-(2,6-dichlorophenyl)-N-phenylacetamide. InChIKey: QCXDNBPNFDEUJZ-UHFFFAOYSA-N.
| Molecular formula | C14H11Cl2NO |
|---|---|
| Molecular weight | 280.1 g/mol |
| IUPAC name | 2-(2,6-dichlorophenyl)-N-phenylacetamide |
| InChIKey | QCXDNBPNFDEUJZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)CC2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)