Products 903324-09-4
CAS 903324-09-4 is the registry number for 3-Chloro-n-(2-chloro-4-methylphenyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-chloro-N-(2-chloro-4-methylphenyl)benzamide (CAS 903324-09-4) is a chemical compound with the molecular formula C14H11Cl2NO and a molecular weight of 280.1 g/mol. IUPAC name: 3-chloro-N-(2-chloro-4-methylphenyl)benzamide. InChIKey: NXYBNYXZPKNIJW-UHFFFAOYSA-N.
| Molecular formula | C14H11Cl2NO |
|---|---|
| Molecular weight | 280.1 g/mol |
| IUPAC name | 3-chloro-N-(2-chloro-4-methylphenyl)benzamide |
| InChIKey | NXYBNYXZPKNIJW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC(=O)C2=CC(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)