CAS 52234-91-0 appears in our catalog under these names: 2,2-Bis(4-chlorophenyl)acetamide, 95%, 2,2–bis(4–chlorophenyl)acetamide, Benzeneacetamide, 4-chloro-α-(4-chlorophenyl)-, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg.
2,2-bis(4-chlorophenyl)acetamide (CAS 52234-91-0) is a chemical compound with the molecular formula C14H11Cl2NO and a molecular weight of 280.1 g/mol. IUPAC name: 2,2-bis(4-chlorophenyl)acetamide. InChIKey: UVLMDCRXONVSBL-UHFFFAOYSA-N.
| Molecular formula | C14H11Cl2NO |
|---|---|
| Molecular weight | 280.1 g/mol |
| IUPAC name | 2,2-bis(4-chlorophenyl)acetamide |
| InChIKey | UVLMDCRXONVSBL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)Cl)C(=O)N)Cl |
Computed by PubChem (NCBI)