Products 1026029-33-3
CAS 1026029-33-3 is the registry number for Methyl 4-(2-Chloropyrimidin-4-Yl)Benzoate, >97%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 10g.
Methyl 4-(2-chloropyrimidin-4-yl)benzoate (CAS 1026029-33-3) is a chemical compound with the molecular formula C12H9ClN2O2 and a molecular weight of 248.66 g/mol. IUPAC name: methyl 4-(2-chloropyrimidin-4-yl)benzoate. InChIKey: COCUEUVOGCFSMB-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2O2 |
|---|---|
| Molecular weight | 248.66 g/mol |
| IUPAC name | methyl 4-(2-chloropyrimidin-4-yl)benzoate |
| InChIKey | COCUEUVOGCFSMB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=NC(=NC=C2)Cl |
Computed by PubChem (NCBI)