CAS 10263-19-1 is the registry number for Cinepazide Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride (CAS 10263-19-1) is a chemical compound with the molecular formula C12H13ClO4 and a molecular weight of 256.68 g/mol. IUPAC name: (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride. InChIKey: NFFPFTGFVSWSTH-SNAWJCMRSA-N.
| Molecular formula | C12H13ClO4 |
|---|---|
| Molecular weight | 256.68 g/mol |
| IUPAC name | (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride |
| InChIKey | NFFPFTGFVSWSTH-SNAWJCMRSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)/C=C/C(=O)Cl |
Computed by PubChem (NCBI)