Products 2172572-27-7
CAS 2172572-27-7 is the registry number for 2-(tert-Butoxycarbonyl)-5-chlorobenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-2-[(2-methylpropan-2-yl)oxycarbonyl]benzoic acid (CAS 2172572-27-7) is a chemical compound with the molecular formula C12H13ClO4 and a molecular weight of 256.68 g/mol. IUPAC name: 5-chloro-2-[(2-methylpropan-2-yl)oxycarbonyl]benzoic acid. InChIKey: NCQRQENKZCFBCC-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO4 |
|---|---|
| Molecular weight | 256.68 g/mol |
| IUPAC name | 5-chloro-2-[(2-methylpropan-2-yl)oxycarbonyl]benzoic acid |
| InChIKey | NCQRQENKZCFBCC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)