Products 750599-11-2

CAS 750599-11-2 is the registry number for (2E)-3-(3-Chloro-5-ethoxy-4-methoxyphenyl)acrylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoic acid (CAS 750599-11-2) is a chemical compound with the molecular formula C12H13ClO4 and a molecular weight of 256.68 g/mol. IUPAC name: (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoic acid. InChIKey: UTWYQAAVDDGOMA-SNAWJCMRSA-N.

Identity
Molecular formulaC12H13ClO4
Molecular weight256.68 g/mol
IUPAC name(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoic acid
InChIKeyUTWYQAAVDDGOMA-SNAWJCMRSA-N
SMILESCCOC1=C(C(=CC(=C1)/C=C/C(=O)O)Cl)OC

Computed by PubChem (NCBI)