Products 862112-39-8

CAS 862112-39-8 is the registry number for 3-(tert-Butoxycarbonyl)-4-chlorobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-chloro-3-[(2-methylpropan-2-yl)oxycarbonyl]benzoic acid (CAS 862112-39-8) is a chemical compound with the molecular formula C12H13ClO4 and a molecular weight of 256.68 g/mol. IUPAC name: 4-chloro-3-[(2-methylpropan-2-yl)oxycarbonyl]benzoic acid. InChIKey: ZQALCISYGQLNBX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13ClO4
Molecular weight256.68 g/mol
IUPAC name4-chloro-3-[(2-methylpropan-2-yl)oxycarbonyl]benzoic acid
InChIKeyZQALCISYGQLNBX-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1=C(C=CC(=C1)C(=O)O)Cl

Computed by PubChem (NCBI)