CAS 143869-67-4 appears in our catalog under these names: Benzyl (chloromethyl) succinate, 97%, Benzyl (chloromethyl) succinate 95%, Benzyl (Chloromethyl) Succinate, 95%, 95%, BENZYL (CHLOROMETHYL) SUCCINATE, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 25g, 250mg.
1-O-benzyl 4-O-(chloromethyl) butanedioate (CAS 143869-67-4) is a chemical compound with the molecular formula C12H13ClO4 and a molecular weight of 256.68 g/mol. IUPAC name: 1-O-benzyl 4-O-(chloromethyl) butanedioate. InChIKey: CSQJMNMWWYYBBG-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO4 |
|---|---|
| Molecular weight | 256.68 g/mol |
| IUPAC name | 1-O-benzyl 4-O-(chloromethyl) butanedioate |
| InChIKey | CSQJMNMWWYYBBG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CCC(=O)OCCl |
Computed by PubChem (NCBI)