Products 36122-30-2
CAS 36122-30-2 appears in our catalog under these names: Dimethyl 2-(4-chlorophenyl)succinate, 95%, Butanedioic acid, 2-(4-chlorophenyl)-, 1,4-dimethyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Dimethyl 2-(4-chlorophenyl)butanedioate (CAS 36122-30-2) is a chemical compound with the molecular formula C12H13ClO4 and a molecular weight of 256.68 g/mol. IUPAC name: dimethyl 2-(4-chlorophenyl)butanedioate. InChIKey: FPVTWKOOQPWSSF-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO4 |
|---|---|
| Molecular weight | 256.68 g/mol |
| IUPAC name | dimethyl 2-(4-chlorophenyl)butanedioate |
| InChIKey | FPVTWKOOQPWSSF-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C1=CC=C(C=C1)Cl)C(=O)OC |
Computed by PubChem (NCBI)