CAS 1026635-23-3 is the registry number for 2,4-Dichloro-4a,5,6,7,8,8a-hexahydroquinazoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-4a,5,6,7,8,8a-hexahydroquinazoline (CAS 1026635-23-3) is a chemical compound with the molecular formula C8H10Cl2N2 and a molecular weight of 205.08 g/mol. IUPAC name: 2,4-dichloro-4a,5,6,7,8,8a-hexahydroquinazoline. InChIKey: WXBQMTWUHFUUHT-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2N2 |
|---|---|
| Molecular weight | 205.08 g/mol |
| IUPAC name | 2,4-dichloro-4a,5,6,7,8,8a-hexahydroquinazoline |
| InChIKey | WXBQMTWUHFUUHT-UHFFFAOYSA-N |
| SMILES | C1CCC2C(C1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)