CAS 130161-51-2 is the registry number for [(2,6-Dichloropyridin-3-yl)methyl]dimethylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
1-(2,6-dichloro-3-pyridinyl)-N,N-dimethylmethanamine (CAS 130161-51-2) is a chemical compound with the molecular formula C8H10Cl2N2 and a molecular weight of 205.08 g/mol. IUPAC name: 1-(2,6-dichloro-3-pyridinyl)-N,N-dimethylmethanamine. InChIKey: QRWKTDIHROBTSG-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2N2 |
|---|---|
| Molecular weight | 205.08 g/mol |
| IUPAC name | 1-(2,6-dichloro-3-pyridinyl)-N,N-dimethylmethanamine |
| InChIKey | QRWKTDIHROBTSG-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=C(N=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)