Products 1037535-38-8
CAS 1037535-38-8 appears in our catalog under these names: 4-tert-Butyl-2,6-dichloropyrimidine, 95%, 4-tert-Butyl-2,6-dichloropyrimidine, 95-<97%, 4-(tert-Butyl)-2,6-dichloropyrimidine, 95+%, 4-tert-Butyl-2,6-dichloropyrimidine. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 2,5g, 5g, 10g, 25g, 50g, 100g.
4-tert-butyl-2,6-dichloropyrimidine (CAS 1037535-38-8) is a chemical compound with the molecular formula C8H10Cl2N2 and a molecular weight of 205.08 g/mol. IUPAC name: 4-tert-butyl-2,6-dichloropyrimidine. InChIKey: JJSOWDBHBXDLTP-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2N2 |
|---|---|
| Molecular weight | 205.08 g/mol |
| IUPAC name | 4-tert-butyl-2,6-dichloropyrimidine |
| InChIKey | JJSOWDBHBXDLTP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=NC(=N1)Cl)Cl |
Computed by PubChem (NCBI)