CAS 1461705-47-4 appears in our catalog under these names: 2,3-Dichloro-5,6-diethylpyrazine, 95%, 2,3-Dichloro-5,6-diethylpyrazine, 98%, 2,3-Dichloro-5,6-diethylpyrazine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g, 50mg.
2,3-dichloro-5,6-diethylpyrazine (CAS 1461705-47-4) is a chemical compound with the molecular formula C8H10Cl2N2 and a molecular weight of 205.08 g/mol. IUPAC name: 2,3-dichloro-5,6-diethylpyrazine. InChIKey: IGPMBOSVPGVGPA-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2N2 |
|---|---|
| Molecular weight | 205.08 g/mol |
| IUPAC name | 2,3-dichloro-5,6-diethylpyrazine |
| InChIKey | IGPMBOSVPGVGPA-UHFFFAOYSA-N |
| SMILES | CCC1=C(N=C(C(=N1)Cl)Cl)CC |
Computed by PubChem (NCBI)