CAS 40779-32-6 is the registry number for N'-(2,3-Dichlorophenyl)ethane-1,2-Diamine . Offered by: Chemat Brand. Available pack sizes: on request.
N'-(2,3-dichlorophenyl)ethane-1,2-diamine (CAS 40779-32-6) is a chemical compound with the molecular formula C8H10Cl2N2 and a molecular weight of 205.08 g/mol. IUPAC name: N'-(2,3-dichlorophenyl)ethane-1,2-diamine. InChIKey: CMAZUWKGYYTYJA-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2N2 |
|---|---|
| Molecular weight | 205.08 g/mol |
| IUPAC name | N'-(2,3-dichlorophenyl)ethane-1,2-diamine |
| InChIKey | CMAZUWKGYYTYJA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)NCCN |
Computed by PubChem (NCBI)