CAS 2174940-52-2 is the registry number for (R)-(1-(2,4-Dichlorophenyl)ethyl)hydrazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1R)-1-(2,4-dichlorophenyl)ethyl]hydrazine (CAS 2174940-52-2) is a chemical compound with the molecular formula C8H10Cl2N2 and a molecular weight of 205.08 g/mol. IUPAC name: [(1R)-1-(2,4-dichlorophenyl)ethyl]hydrazine. InChIKey: FKSIGVWCIYERMC-RXMQYKEDSA-N.
| Molecular formula | C8H10Cl2N2 |
|---|---|
| Molecular weight | 205.08 g/mol |
| IUPAC name | [(1R)-1-(2,4-dichlorophenyl)ethyl]hydrazine |
| InChIKey | FKSIGVWCIYERMC-RXMQYKEDSA-N |
| SMILES | C[C@H](C1=C(C=C(C=C1)Cl)Cl)NN |
Computed by PubChem (NCBI)