Products 1026645-16-8
CAS 1026645-16-8 is the registry number for 1-Benzyl-5-chloro-1H-indole-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-benzyl-5-chloroindole-2-carboxylic acid (CAS 1026645-16-8) is a chemical compound with the molecular formula C16H12ClNO2 and a molecular weight of 285.72 g/mol. IUPAC name: 1-benzyl-5-chloroindole-2-carboxylic acid. InChIKey: ZKLFRWIEGLBBEE-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNO2 |
|---|---|
| Molecular weight | 285.72 g/mol |
| IUPAC name | 1-benzyl-5-chloroindole-2-carboxylic acid |
| InChIKey | ZKLFRWIEGLBBEE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=C(C=C(C=C3)Cl)C=C2C(=O)O |
Computed by PubChem (NCBI)