CAS 1026685-55-1 is the registry number for Varenicline Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaene-14-carboxylic acid (CAS 1026685-55-1) is a chemical compound with the molecular formula C14H13N3O2 and a molecular weight of 255.27 g/mol. IUPAC name: 5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaene-14-carboxylic acid. InChIKey: DPKXSOCWNABKSB-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O2 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaene-14-carboxylic acid |
| InChIKey | DPKXSOCWNABKSB-UHFFFAOYSA-N |
| SMILES | C1C2CN(CC1C3=CC4=NC=CN=C4C=C23)C(=O)O |
Computed by PubChem (NCBI)