Products 10268-12-9
CAS 10268-12-9 appears in our catalog under these names: Methyl 3–Nitrophenylacetate, Methyl 3-Nitrophenylacetate, >98.0%(GC), Methyl 3-Nitrophenylacetate 98%, Methyl 3-Nitrophenylacetate, 98%, 98%, Methyl 2-(3-nitrophenyl)acetate, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 25g, 100g, 10g.
Methyl 2-(3-nitrophenyl)acetate (CAS 10268-12-9) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: methyl 2-(3-nitrophenyl)acetate. InChIKey: BFGYITRIATVARH-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | methyl 2-(3-nitrophenyl)acetate |
| InChIKey | BFGYITRIATVARH-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)