CAS 1026962-68-4 appears in our catalog under these names: 6–Bromo–2–fluoro–3–(trifluoromethyl)benzoic acid, 6-Bromo-2-fluoro-3-(trifluoromethyl)benzoic acid 98%, 6-Bromo-2-fluoro-3-(trifluoromethyl)benzoic acid, 98%, 98%, 6-BROMO-2-FLUORO-3-(TRIFLUOROMETHYL)BENZOIC ACID, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 25g, 100g.
6-bromo-2-fluoro-3-(trifluoromethyl)benzoic acid (CAS 1026962-68-4) is a chemical compound with the molecular formula C8H3BrF4O2 and a molecular weight of 287.01 g/mol. IUPAC name: 6-bromo-2-fluoro-3-(trifluoromethyl)benzoic acid. InChIKey: IFMFJFGMOSTGLZ-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF4O2 |
|---|---|
| Molecular weight | 287.01 g/mol |
| IUPAC name | 6-bromo-2-fluoro-3-(trifluoromethyl)benzoic acid |
| InChIKey | IFMFJFGMOSTGLZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)F)C(=O)O)Br |
Computed by PubChem (NCBI)