Products 1800423-60-2
CAS 1800423-60-2 appears in our catalog under these names: 2-Bromo-6-fluoro-4-(trifluoromethyl)benzoic acid, 95%, 2-BROMO-6-FLUORO-4-(TRIFLUOROMETHYL)BENZOIC ACID, 98%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 100mg.
2-bromo-6-fluoro-4-(trifluoromethyl)benzoic acid (CAS 1800423-60-2) is a chemical compound with the molecular formula C8H3BrF4O2 and a molecular weight of 287.01 g/mol. IUPAC name: 2-bromo-6-fluoro-4-(trifluoromethyl)benzoic acid. InChIKey: HRARIOBAKONHEU-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF4O2 |
|---|---|
| Molecular weight | 287.01 g/mol |
| IUPAC name | 2-bromo-6-fluoro-4-(trifluoromethyl)benzoic acid |
| InChIKey | HRARIOBAKONHEU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C(=O)O)Br)C(F)(F)F |
Computed by PubChem (NCBI)