Products 194804-96-1

CAS 194804-96-1 is the registry number for 4-Bromo-2-fluoro-3-(trifluoromethyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

4-bromo-2-fluoro-3-(trifluoromethyl)benzoic acid (CAS 194804-96-1) is a chemical compound with the molecular formula C8H3BrF4O2 and a molecular weight of 287.01 g/mol. IUPAC name: 4-bromo-2-fluoro-3-(trifluoromethyl)benzoic acid. InChIKey: PHLNXVHMVADJBE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3BrF4O2
Molecular weight287.01 g/mol
IUPAC name4-bromo-2-fluoro-3-(trifluoromethyl)benzoic acid
InChIKeyPHLNXVHMVADJBE-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1C(=O)O)F)C(F)(F)F)Br

Computed by PubChem (NCBI)