CAS 141872-90-4 is the registry number for 6-Bromo-2,2,3,3-tetrafluorobenzodioxane, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-bromo-2,2,3,3-tetrafluoro-1,4-benzodioxine (CAS 141872-90-4) is a chemical compound with the molecular formula C8H3BrF4O2 and a molecular weight of 287.01 g/mol. IUPAC name: 6-bromo-2,2,3,3-tetrafluoro-1,4-benzodioxine. InChIKey: NFBZNZNRSMRQDC-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF4O2 |
|---|---|
| Molecular weight | 287.01 g/mol |
| IUPAC name | 6-bromo-2,2,3,3-tetrafluoro-1,4-benzodioxine |
| InChIKey | NFBZNZNRSMRQDC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)OC(C(O2)(F)F)(F)F |
Computed by PubChem (NCBI)