CAS 53001-69-7 is the registry number for Methyl 3-bromo-2,4,5,6-tetrafluorobenzoate 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
Methyl 3-bromo-2,4,5,6-tetrafluorobenzoate (CAS 53001-69-7) is a chemical compound with the molecular formula C8H3BrF4O2 and a molecular weight of 287.01 g/mol. IUPAC name: methyl 3-bromo-2,4,5,6-tetrafluorobenzoate. InChIKey: NIYINRANWFEORK-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF4O2 |
|---|---|
| Molecular weight | 287.01 g/mol |
| IUPAC name | methyl 3-bromo-2,4,5,6-tetrafluorobenzoate |
| InChIKey | NIYINRANWFEORK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C(=C1F)Br)F)F)F |
Computed by PubChem (NCBI)