CAS 1699741-92-8 appears in our catalog under these names: 5-Bromo-2-fluoro-4-(trifluoromethyl)benzoic acid, 95%, 5-bromo-2-fluoro-4-(trifluoromethyl)benzoic acid, 5-Bromo-2-fluoro-4-(trifluoromethyl)benzoic acid 97%, 5-Bromo-2-fluoro-4-(trifluoromethyl)benzoic acid, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 2,5g, 100mg.
5-bromo-2-fluoro-4-(trifluoromethyl)benzoic acid (CAS 1699741-92-8) is a chemical compound with the molecular formula C8H3BrF4O2 and a molecular weight of 287.01 g/mol. IUPAC name: 5-bromo-2-fluoro-4-(trifluoromethyl)benzoic acid. InChIKey: SKRBSHQZFMLXRP-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF4O2 |
|---|---|
| Molecular weight | 287.01 g/mol |
| IUPAC name | 5-bromo-2-fluoro-4-(trifluoromethyl)benzoic acid |
| InChIKey | SKRBSHQZFMLXRP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)C(F)(F)F)F)C(=O)O |
Computed by PubChem (NCBI)