CAS 1028648-22-7 appears in our catalog under these names: 9-(4-Phenylphenyl)carbazole-3-boronic acid, 95%, (9-([1,1'-Biphenyl]-4-yl)-9H-carbazol-3-yl)boronic acid 98%, 9-(Biphenyl-4-yl)-9H-carbazol-3-yl)-boronic acid, 98%, 98%, 9-(4-Phenylphenyl)carbazole-3-boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g.
[9-(4-phenylphenyl)carbazol-3-yl]boronic acid (CAS 1028648-22-7) is a chemical compound with the molecular formula C24H18BNO2 and a molecular weight of 363.2 g/mol. IUPAC name: [9-(4-phenylphenyl)carbazol-3-yl]boronic acid. InChIKey: HUSSQXMWKXPRRF-UHFFFAOYSA-N.
| Molecular formula | C24H18BNO2 |
|---|---|
| Molecular weight | 363.2 g/mol |
| IUPAC name | [9-(4-phenylphenyl)carbazol-3-yl]boronic acid |
| InChIKey | HUSSQXMWKXPRRF-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N(C3=CC=CC=C32)C4=CC=C(C=C4)C5=CC=CC=C5)(O)O |
Computed by PubChem (NCBI)