CAS 1133058-06-6 appears in our catalog under these names: 6,9-Diphenyl-9H-carbazole-3-boronic Acid (contains varying amounts of Anhydride), 6,9-Diphenyl-9H-carbazol-3-yl-3-boronic acid, 95%, 95%, 6,9-Diphenyl-9H-carbazol-3-yl-3-boronic acid, 95%. Offered by: TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 200mg, 1g, 250mg, 5g, 10g, 25g.
(6,9-diphenylcarbazol-3-yl)boronic acid (CAS 1133058-06-6) is a chemical compound with the molecular formula C24H18BNO2 and a molecular weight of 363.2 g/mol. IUPAC name: (6,9-diphenylcarbazol-3-yl)boronic acid. InChIKey: AIDQRXUWQFRMAQ-UHFFFAOYSA-N.
| Molecular formula | C24H18BNO2 |
|---|---|
| Molecular weight | 363.2 g/mol |
| IUPAC name | (6,9-diphenylcarbazol-3-yl)boronic acid |
| InChIKey | AIDQRXUWQFRMAQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N(C3=C2C=C(C=C3)C4=CC=CC=C4)C5=CC=CC=C5)(O)O |
Computed by PubChem (NCBI)