Products 858131-73-4

CAS 858131-73-4 appears in our catalog under these names: [4'-(Carbazol-9-yl)-4-biphenylyl]boronic acid, 97%, [4'-(Carbazol-9-yl)-4-biphenylyl]boronic acid, 98%, 98%, (4'-(9H-Carbazol-9-yl)-[1,1'-biphenyl]-4-yl)boronic acid 98%, (4'-(9H-Carbazol-9-yl)-[1,1'-biphenyl]-4-yl)boronic acid, 98%, [4'-(Carbazol-9-yl)-4-biphenylyl]boronic Acid (contains varying amounts of Anhydride). Offered by: Combi-blocks, Chemat, Ambeed, Fluorochem, TCI. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

[4-(4-carbazol-9-ylphenyl)phenyl]boronic acid (CAS 858131-73-4) is a chemical compound with the molecular formula C24H18BNO2 and a molecular weight of 363.2 g/mol. IUPAC name: [4-(4-carbazol-9-ylphenyl)phenyl]boronic acid. InChIKey: YVBMFCFOASRILM-UHFFFAOYSA-N.

Identity
Molecular formulaC24H18BNO2
Molecular weight363.2 g/mol
IUPAC name[4-(4-carbazol-9-ylphenyl)phenyl]boronic acid
InChIKeyYVBMFCFOASRILM-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)C2=CC=C(C=C2)N3C4=CC=CC=C4C5=CC=CC=C53)(O)O

Computed by PubChem (NCBI)