Products 2478569-92-3
CAS 2478569-92-3 appears in our catalog under these names: (2-(2-Phenyl-9H-carbazol-9-yl)phenyl)boronic acid, 95%, 95%, (2-(2-Phenyl-9H-carbazol-9-yl)phenyl)boronic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 1g, 25g, 5g.
[2-(2-phenylcarbazol-9-yl)phenyl]boronic acid (CAS 2478569-92-3) is a chemical compound with the molecular formula C24H18BNO2 and a molecular weight of 363.2 g/mol. IUPAC name: [2-(2-phenylcarbazol-9-yl)phenyl]boronic acid. InChIKey: OPIADNMNLNSZPA-UHFFFAOYSA-N.
| Molecular formula | C24H18BNO2 |
|---|---|
| Molecular weight | 363.2 g/mol |
| IUPAC name | [2-(2-phenylcarbazol-9-yl)phenyl]boronic acid |
| InChIKey | OPIADNMNLNSZPA-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1N2C3=CC=CC=C3C4=C2C=C(C=C4)C5=CC=CC=C5)(O)O |
Computed by PubChem (NCBI)