CAS 1686100-04-8 appears in our catalog under these names: Boronic acid, b-(9-[1,1'-biphenyl]-4-yl-9h-carbazol-2-yl)-, 95%, Boronic acid, b–(9–(1,1'–biphenyl)–4–yl–9h–carbazol–2–yl)–, 9-(Biphenyl-4-yl)carbazole-2-boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
[9-(4-phenylphenyl)carbazol-2-yl]boronic acid (CAS 1686100-04-8) is a chemical compound with the molecular formula C24H18BNO2 and a molecular weight of 363.2 g/mol. IUPAC name: [9-(4-phenylphenyl)carbazol-2-yl]boronic acid. InChIKey: BORLELIEOILAEA-UHFFFAOYSA-N.
| Molecular formula | C24H18BNO2 |
|---|---|
| Molecular weight | 363.2 g/mol |
| IUPAC name | [9-(4-phenylphenyl)carbazol-2-yl]boronic acid |
| InChIKey | BORLELIEOILAEA-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C3=CC=CC=C3N2C4=CC=C(C=C4)C5=CC=CC=C5)(O)O |
Computed by PubChem (NCBI)