CAS 854952-60-6 appears in our catalog under these names: (3–(9–Phenyl–9H–carbazol–3–yl)phenyl)boronic acid, 3-(9-Phenyl-9H-carbazol-3-yl)phenylboronic acid. Offered by: GLPBio, Chemat. Available pack sizes: 10g, 250mg, 1g, 5g.
[3-(9-phenylcarbazol-3-yl)phenyl]boronic acid (CAS 854952-60-6) is a chemical compound with the molecular formula C24H18BNO2 and a molecular weight of 363.2 g/mol. IUPAC name: [3-(9-phenylcarbazol-3-yl)phenyl]boronic acid. InChIKey: WPWPOMNBTQPHDV-UHFFFAOYSA-N.
| Molecular formula | C24H18BNO2 |
|---|---|
| Molecular weight | 363.2 g/mol |
| IUPAC name | [3-(9-phenylcarbazol-3-yl)phenyl]boronic acid |
| InChIKey | WPWPOMNBTQPHDV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2=CC3=C(C=C2)N(C4=CC=CC=C43)C5=CC=CC=C5)(O)O |
Computed by PubChem (NCBI)