CAS 102872-00-4 appears in our catalog under these names: 5-Benzamidolevulinic Acid, >95% (HPLC), 5-Benzamidolevulinic acid. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 250mg, 25mg, 50mg.
5-benzamido-4-oxopentanoic acid (CAS 102872-00-4) is a chemical compound with the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. IUPAC name: 5-benzamido-4-oxopentanoic acid. InChIKey: IITDXGVVBHAMHN-UHFFFAOYSA-N.
| Molecular formula | C12H13NO4 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 5-benzamido-4-oxopentanoic acid |
| InChIKey | IITDXGVVBHAMHN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NCC(=O)CCC(=O)O |
Computed by PubChem (NCBI)