CAS 102878-19-3 appears in our catalog under these names: 2,4-Dichloro-7-methylquinoline, >95% (HPLC), 2,4–Dichloro–7–methylquinoline, 2,4-Dichloro-7-methylquinoline 95%. Offered by: TRC, GLPBio, Ambeed. Available pack sizes: 100mg, 1g, 500mg, 250mg.
2,4-dichloro-7-methylquinoline (CAS 102878-19-3) is a chemical compound with the molecular formula C10H7Cl2N and a molecular weight of 212.07 g/mol. IUPAC name: 2,4-dichloro-7-methylquinoline. InChIKey: JGHBQTZHZQXVAM-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 2,4-dichloro-7-methylquinoline |
| InChIKey | JGHBQTZHZQXVAM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)