Products 102879-44-7
CAS 102879-44-7 appears in our catalog under these names: 3-(3-Aminophenyl)propanoic acid hydrochloride, 97%, beta-(3-Aminophenyl)propionic acid hydrochloride, 3-(3-Aminophenyl)propanoic acid hydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 500mg, 1000mg, 2000mg, 25g.
3-(3-aminophenyl)propanoic acid;hydrochloride (CAS 102879-44-7) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: 3-(3-aminophenyl)propanoic acid;hydrochloride. InChIKey: QBOBODDISCLHPG-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | 3-(3-aminophenyl)propanoic acid;hydrochloride |
| InChIKey | QBOBODDISCLHPG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)CCC(=O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
3-(3-aminophenyl)propanoic acid hydrochloride, 3-(3-aminophenyl)propanoic acid;hydrochloride, beta-(3-aminophenyl)propionic acid hydrochloride, 3-(3-Aminophenyl)propanoicacidhydrochloride, 3-(3-Aminophenyl)propanoic Acid HCl, 3-Aminobenzenepropanoic acid hydrochloride, 3-(3-Amino-phenyl)-propionicacidHydrochloride, 3-(3-amino-phenyl)-propionic acid, hydrochloride, 3-(3-Aminophenyl)propanoic acid--hydrogen chloride (1/1)