CAS 941400-53-9 appears in our catalog under these names: 2-(1H-1,2,4-Triazol-1-yl)nicotinic acid, 95%, 2-(1H-1,2,4-Triazol-1-yl)nicotinic acid, 95+%, 2-(1H-1,2,4-Triazol-1-yl)pyridine-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
2-(1,2,4-triazol-1-yl)pyridine-3-carboxylic acid (CAS 941400-53-9) is a chemical compound with the molecular formula C8H6N4O2 and a molecular weight of 190.16 g/mol. IUPAC name: 2-(1,2,4-triazol-1-yl)pyridine-3-carboxylic acid. InChIKey: JVRBJJCNDSCZJV-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O2 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 2-(1,2,4-triazol-1-yl)pyridine-3-carboxylic acid |
| InChIKey | JVRBJJCNDSCZJV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)N2C=NC=N2)C(=O)O |
Computed by PubChem (NCBI)