Products 103008-86-2

CAS 103008-86-2 is the registry number for Diethyl 4,5-dihydroxycyclopenta-3,5-diene-1,3-dicarboxylate, 98%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 1g.

Diethyl 4,5-dihydroxycyclopenta-3,5-diene-1,3-dicarboxylate (CAS 103008-86-2) is a chemical compound with the molecular formula C11H14O6 and a molecular weight of 242.22 g/mol. IUPAC name: diethyl 4,5-dihydroxycyclopenta-3,5-diene-1,3-dicarboxylate. InChIKey: DIECDYKPEFJMCO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O6
Molecular weight242.22 g/mol
IUPAC namediethyl 4,5-dihydroxycyclopenta-3,5-diene-1,3-dicarboxylate
InChIKeyDIECDYKPEFJMCO-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C(=C(C1)C(=O)OCC)O)O

Computed by PubChem (NCBI)