CAS 103008-86-2 is the registry number for Diethyl 4,5-dihydroxycyclopenta-3,5-diene-1,3-dicarboxylate, 98%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 1g.
Diethyl 4,5-dihydroxycyclopenta-3,5-diene-1,3-dicarboxylate (CAS 103008-86-2) is a chemical compound with the molecular formula C11H14O6 and a molecular weight of 242.22 g/mol. IUPAC name: diethyl 4,5-dihydroxycyclopenta-3,5-diene-1,3-dicarboxylate. InChIKey: DIECDYKPEFJMCO-UHFFFAOYSA-N.
| Molecular formula | C11H14O6 |
|---|---|
| Molecular weight | 242.22 g/mol |
| IUPAC name | diethyl 4,5-dihydroxycyclopenta-3,5-diene-1,3-dicarboxylate |
| InChIKey | DIECDYKPEFJMCO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(C1)C(=O)OCC)O)O |
Computed by PubChem (NCBI)