Products 13212-99-2

CAS 13212-99-2 is the registry number for 2-Hydroxy-2-(3,4,5-trimethoxyphenyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-hydroxy-2-(3,4,5-trimethoxyphenyl)acetic acid (CAS 13212-99-2) is a chemical compound with the molecular formula C11H14O6 and a molecular weight of 242.22 g/mol. IUPAC name: 2-hydroxy-2-(3,4,5-trimethoxyphenyl)acetic acid. InChIKey: NFFATBGXXISZCM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O6
Molecular weight242.22 g/mol
IUPAC name2-hydroxy-2-(3,4,5-trimethoxyphenyl)acetic acid
InChIKeyNFFATBGXXISZCM-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1OC)OC)C(C(=O)O)O

Computed by PubChem (NCBI)