Products 65876-10-0

CAS 65876-10-0 is the registry number for 2-(3,4,5-Trimethoxyphenoxy)acetic acid, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g.

2-(3,4,5-trimethoxyphenoxy)acetic acid (CAS 65876-10-0) is a chemical compound with the molecular formula C11H14O6 and a molecular weight of 242.22 g/mol. IUPAC name: 2-(3,4,5-trimethoxyphenoxy)acetic acid. InChIKey: DUUIKSNOGTVREZ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O6
Molecular weight242.22 g/mol
IUPAC name2-(3,4,5-trimethoxyphenoxy)acetic acid
InChIKeyDUUIKSNOGTVREZ-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1OC)OC)OCC(=O)O

Computed by PubChem (NCBI)