Products 959150-61-9
CAS 959150-61-9 appears in our catalog under these names: 6–epi COTC, 6-epi-COTC. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg.
[(3R,4R,5S)-3,4,5-trihydroxy-6-oxocyclohexen-1-yl]methyl (E)-but-2-enoate (CAS 959150-61-9) is a chemical compound with the molecular formula C11H14O6 and a molecular weight of 242.22 g/mol. IUPAC name: [(3R,4R,5S)-3,4,5-trihydroxy-6-oxocyclohexen-1-yl]methyl (E)-but-2-enoate. InChIKey: PSJQCAMBOYBQEU-GHIXNCGPSA-N.
| Molecular formula | C11H14O6 |
|---|---|
| Molecular weight | 242.22 g/mol |
| IUPAC name | [(3R,4R,5S)-3,4,5-trihydroxy-6-oxocyclohexen-1-yl]methyl (E)-but-2-enoate |
| InChIKey | PSJQCAMBOYBQEU-GHIXNCGPSA-N |
| SMILES | C/C=C/C(=O)OCC1=C[C@H]([C@H]([C@@H](C1=O)O)O)O |
Computed by PubChem (NCBI)