CAS 644990-10-3 is the registry number for 2-Hydroxy-2-(2,4,6-trimethoxyphenyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-hydroxy-2-(2,4,6-trimethoxyphenyl)acetic acid (CAS 644990-10-3) is a chemical compound with the molecular formula C11H14O6 and a molecular weight of 242.22 g/mol. IUPAC name: 2-hydroxy-2-(2,4,6-trimethoxyphenyl)acetic acid. InChIKey: FJVBJSIAIUCVKM-UHFFFAOYSA-N.
| Molecular formula | C11H14O6 |
|---|---|
| Molecular weight | 242.22 g/mol |
| IUPAC name | 2-hydroxy-2-(2,4,6-trimethoxyphenyl)acetic acid |
| InChIKey | FJVBJSIAIUCVKM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)C(C(=O)O)O)OC |
Computed by PubChem (NCBI)