Products 57449-30-6
CAS 57449-30-6 is the registry number for COTC. Offered by: GLPBio, TargetMol, MedChemExpress. Available pack sizes: 1mg, Get quote.
[(3R,4R,5R)-3,4,5-trihydroxy-6-oxocyclohexen-1-yl]methyl but-2-enoate (CAS 57449-30-6) is a chemical compound with the molecular formula C11H14O6 and a molecular weight of 242.22 g/mol. IUPAC name: [(3R,4R,5R)-3,4,5-trihydroxy-6-oxocyclohexen-1-yl]methyl but-2-enoate. InChIKey: PSJQCAMBOYBQEU-ONOSFVFSSA-N.
| Molecular formula | C11H14O6 |
|---|---|
| Molecular weight | 242.22 g/mol |
| IUPAC name | [(3R,4R,5R)-3,4,5-trihydroxy-6-oxocyclohexen-1-yl]methyl but-2-enoate |
| InChIKey | PSJQCAMBOYBQEU-ONOSFVFSSA-N |
| SMILES | CC=CC(=O)OCC1=C[C@H]([C@H]([C@H](C1=O)O)O)O |
Computed by PubChem (NCBI)