CAS 1030574-44-7 appears in our catalog under these names: 4-(5-Chloro-2-benzimidazolyl)-n,n-dimethylaniline, 95%, 4-(5-Chloro-2-benzimidazolyl)-n,n-dimethylaniline, 98%, 98%, 4-(6-Chloro-1H-benzo[d]imidazol-2-yl)-N,N-dimethylaniline, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
4-(6-chloro-1H-benzimidazol-2-yl)-N,N-dimethylaniline (CAS 1030574-44-7) is a chemical compound with the molecular formula C15H14ClN3 and a molecular weight of 271.74 g/mol. IUPAC name: 4-(6-chloro-1H-benzimidazol-2-yl)-N,N-dimethylaniline. InChIKey: SBZBJIZOURDIBQ-UHFFFAOYSA-N.
| Molecular formula | C15H14ClN3 |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | 4-(6-chloro-1H-benzimidazol-2-yl)-N,N-dimethylaniline |
| InChIKey | SBZBJIZOURDIBQ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=NC3=C(N2)C=C(C=C3)Cl |
Computed by PubChem (NCBI)