Products 1097805-12-3
CAS 1097805-12-3 is the registry number for 4-Chloro-3-((2-methyl-1H-1,3-benzodiazol-1-yl)methyl)aniline. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-chloro-3-[(2-methylbenzimidazol-1-yl)methyl]aniline (CAS 1097805-12-3) is a chemical compound with the molecular formula C15H14ClN3 and a molecular weight of 271.74 g/mol. IUPAC name: 4-chloro-3-[(2-methylbenzimidazol-1-yl)methyl]aniline. InChIKey: KXRLDAQDFLIDQT-UHFFFAOYSA-N.
| Molecular formula | C15H14ClN3 |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | 4-chloro-3-[(2-methylbenzimidazol-1-yl)methyl]aniline |
| InChIKey | KXRLDAQDFLIDQT-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC=CC=C2N1CC3=C(C=CC(=C3)N)Cl |
Computed by PubChem (NCBI)