CAS 173458-80-5 appears in our catalog under these names: 7-Benzyl-4-chloro-5,6-dimethyl-7H-pyrrolo(2,3-d)pyrimidine, 7-Benzyl-4-chloro-5,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine, 90%, 90%, 7-Benzyl-4-chloro-5,6-dimethyl-7h-pyrrolo[2,3-d]pyrimidine, 90%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g, 5g.
7-benzyl-4-chloro-5,6-dimethylpyrrolo[2,3-d]pyrimidine (CAS 173458-80-5) is a chemical compound with the molecular formula C15H14ClN3 and a molecular weight of 271.74 g/mol. IUPAC name: 7-benzyl-4-chloro-5,6-dimethylpyrrolo[2,3-d]pyrimidine. InChIKey: OWTBZRBZLBQVFN-UHFFFAOYSA-N.
| Molecular formula | C15H14ClN3 |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | 7-benzyl-4-chloro-5,6-dimethylpyrrolo[2,3-d]pyrimidine |
| InChIKey | OWTBZRBZLBQVFN-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C2=C1C(=NC=N2)Cl)CC3=CC=CC=C3)C |
Computed by PubChem (NCBI)