CAS 1450-96-0 is the registry number for 4,5-Diphenyl-1H-imidazol-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4,5-diphenyl-1H-imidazol-2-amine;hydrochloride (CAS 1450-96-0) is a chemical compound with the molecular formula C15H14ClN3 and a molecular weight of 271.74 g/mol. IUPAC name: 4,5-diphenyl-1H-imidazol-2-amine;hydrochloride. InChIKey: KBLNGNRGRVAEQL-UHFFFAOYSA-N.
| Molecular formula | C15H14ClN3 |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | 4,5-diphenyl-1H-imidazol-2-amine;hydrochloride |
| InChIKey | KBLNGNRGRVAEQL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C(N2)N)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)